C14H12N2O6S — CID 11702779
N-(3,4-dihydroxyphenyl)-7-hydroxy-2,2-dioxo-1,3-dihydro-2,1-benzothiazole-4-carboxamide (PubChem CID 11702779) has the molecular formula C14H12N2O6S and a molecular weight of 336.33 g/mol. Its IUPAC name is N-(3,4-dihydroxyphenyl)-7-hydroxy-2,2-dioxo-1,3-dihydro-2,1-benzothiazole-4-carboxamide.
| Compound Name | N-(3,4-dihydroxyphenyl)-7-hydroxy-2,2-dioxo-1,3-dihydro-2,1-benzothiazole-4-carboxamide |
|---|---|
| PubChem CID | 11702779 |
| Molecular Formula | C14H12N2O6S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-(3,4-dihydroxyphenyl)-7-hydroxy-2,2-dioxo-1,3-dihydro-2,1-benzothiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(O)c1)c1ccc(O)c2c1CS(=O)(=O)N2 |
| InChI | InChI=1S/C14H12N2O6S/c17-10-3-1-7(5-12(10)19)15-14(20)8-2-4-11(18)13-9(8)6-23(21,22)16-13/h1-5,16-19H,6H2,(H,15,20) |
| InChIKey | UAGUDOMMOQDGLL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|