C11H14N2O3S — CID 117029952
2-[3-(methylamino)phenyl]-1,1-dioxothiazinan-3-one (PubChem CID 117029952) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-[3-(methylamino)phenyl]-1,1-dioxothiazinan-3-one.
| Compound Name | 2-[3-(methylamino)phenyl]-1,1-dioxothiazinan-3-one |
|---|---|
| PubChem CID | 117029952 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[3-(methylamino)phenyl]-1,1-dioxothiazinan-3-one |
| SMILES | CNc1cccc(N2C(=O)CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C11H14N2O3S/c1-12-9-4-2-5-10(8-9)13-11(14)6-3-7-17(13,15)16/h2,4-5,8,12H,3,6-7H2,1H3 |
| InChIKey | AVFFLCWJNPLSIV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |