C12H13Cl6NO5 — CID 117065870
[6a-acetamido-2,5-bis(trichloromethyl)-2,3,4,5-tetrahydrofuro[2,3-b]furan-3a-yl] acetate (PubChem CID 117065870) has the molecular formula C12H13Cl6NO5 and a molecular weight of 463.96 g/mol. Its IUPAC name is [6a-acetamido-2,5-bis(trichloromethyl)-2,3,4,5-tetrahydrofuro[2,3-b]furan-3a-yl] acetate.
| Compound Name | [6a-acetamido-2,5-bis(trichloromethyl)-2,3,4,5-tetrahydrofuro[2,3-b]furan-3a-yl] acetate |
|---|---|
| PubChem CID | 117065870 |
| Molecular Formula | C12H13Cl6NO5 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 460.89 |
| IUPAC Name | [6a-acetamido-2,5-bis(trichloromethyl)-2,3,4,5-tetrahydrofuro[2,3-b]furan-3a-yl] acetate |
| SMILES | CC(=O)NC12OC(C(Cl)(Cl)Cl)CC1(OC(C)=O)CC(C(Cl)(Cl)Cl)O2 |
| InChI | InChI=1S/C12H13Cl6NO5/c1-5(20)19-12-9(22-6(2)21,3-7(23-12)10(13,14)15)4-8(24-12)11(16,17)18/h7-8H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | GSATYCWIVLEIEJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|