C22H17N7O — CID 117092787
6-N-(4-phenoxyphenyl)-8-N-pyridin-2-yl-7H-purine-6,8-diamine (PubChem CID 117092787) has the molecular formula C22H17N7O and a molecular weight of 395.43 g/mol. Its IUPAC name is 6-N-(4-phenoxyphenyl)-8-N-pyridin-2-yl-7H-purine-6,8-diamine.
| Compound Name | 6-N-(4-phenoxyphenyl)-8-N-pyridin-2-yl-7H-purine-6,8-diamine |
|---|---|
| PubChem CID | 117092787 |
| Molecular Formula | C22H17N7O |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 6-N-(4-phenoxyphenyl)-8-N-pyridin-2-yl-7H-purine-6,8-diamine |
| SMILES | c1ccc(Oc2ccc(Nc3ncnc4nc(Nc5ccccn5)[nH]c34)cc2)cc1 |
| InChI | InChI=1S/C22H17N7O/c1-2-6-16(7-3-1)30-17-11-9-15(10-12-17)26-20-19-21(25-14-24-20)29-22(28-19)27-18-8-4-5-13-23-18/h1-14H,(H3,23,24,25,26,27,28,29) |
| InChIKey | VADQSFWZIPWLFU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |