C8H5ClF4O — CID 117114438
2-(4-chloro-2,3,5,6-tetrafluorophenyl)ethanol (PubChem CID 117114438) has the molecular formula C8H5ClF4O and a molecular weight of 228.57 g/mol. Its IUPAC name is 2-(4-chloro-2,3,5,6-tetrafluorophenyl)ethanol.
| Compound Name | 2-(4-chloro-2,3,5,6-tetrafluorophenyl)ethanol |
|---|---|
| PubChem CID | 117114438 |
| Molecular Formula | C8H5ClF4O |
| Molecular Weight | 228.57 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 2-(4-chloro-2,3,5,6-tetrafluorophenyl)ethanol |
| SMILES | OCCc1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C8H5ClF4O/c9-4-7(12)5(10)3(1-2-14)6(11)8(4)13/h14H,1-2H2 |
| InChIKey | BIXGJBIHMUZAIA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|