About 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine
3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine (PubChem CID 115113372) has the molecular formula C9H8ClF4N
and a molecular weight of 241.61 g/mol. Its IUPAC name is 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine |
| PubChem CID | 115113372 |
| Molecular Formula | C9H8ClF4N |
| Molecular Weight | 241.61 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine |
| SMILES | NCCCc1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C9H8ClF4N/c10-5-8(13)6(11)4(2-1-3-15)7(12)9(5)14/h1-3,15H2 |
| InChIKey | CMYDYKKTBAAGTH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.61 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine?
The IUPAC name of 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine (CID 115113372) is 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine.
What is the SMILES notation for 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine?
The canonical SMILES for 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine is NCCCc1c(F)c(F)c(Cl)c(F)c1F.
What is the InChIKey of 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine?
The InChIKey is CMYDYKKTBAAGTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClF4N/c10-5-8(13)6(11)4(2-1-3-15)7(12)9(5)14/h1-3,15H2.
What are the key properties of 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine?
3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine has a molecular weight of 241.61 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chloro-2,3,5,6-tetrafluorophenyl)propan-1-amine is sourced from PubChem (CID 115113372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).