C8H6BrClF3N — CID 117110898
2-(4-bromo-2-chloro-3,5,6-trifluorophenyl)ethanamine (PubChem CID 117110898) has the molecular formula C8H6BrClF3N and a molecular weight of 288.49 g/mol. Its IUPAC name is 2-(4-bromo-2-chloro-3,5,6-trifluorophenyl)ethanamine.
| Compound Name | 2-(4-bromo-2-chloro-3,5,6-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 117110898 |
| Molecular Formula | C8H6BrClF3N |
| Molecular Weight | 288.49 g/mol |
| Exact Mass | 286.93 |
| IUPAC Name | 2-(4-bromo-2-chloro-3,5,6-trifluorophenyl)ethanamine |
| SMILES | NCCc1c(F)c(F)c(Br)c(F)c1Cl |
| InChI | InChI=1S/C8H6BrClF3N/c9-4-7(12)5(10)3(1-2-14)6(11)8(4)13/h1-2,14H2 |
| InChIKey | WOBMTLRWFWBGGT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|