C9H16O3S — CID 117168837
2-[2-(thiolan-2-yl)-1,3-dioxolan-4-yl]ethanol (PubChem CID 117168837) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-[2-(thiolan-2-yl)-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[2-(thiolan-2-yl)-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 117168837 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-[2-(thiolan-2-yl)-1,3-dioxolan-4-yl]ethanol |
| SMILES | OCCC1COC(C2CCCS2)O1 |
| InChI | InChI=1S/C9H16O3S/c10-4-3-7-6-11-9(12-7)8-2-1-5-13-8/h7-10H,1-6H2 |
| InChIKey | AYQAPWIFYHSSMO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |