C13H18BrN — CID 117193897
7-bromo-2-ethyl-2,3-dimethyl-3,4-dihydro-1H-quinoline (PubChem CID 117193897) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 7-bromo-2-ethyl-2,3-dimethyl-3,4-dihydro-1H-quinoline.
| Compound Name | 7-bromo-2-ethyl-2,3-dimethyl-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 117193897 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 7-bromo-2-ethyl-2,3-dimethyl-3,4-dihydro-1H-quinoline |
| SMILES | CCC1(C)Nc2cc(Br)ccc2CC1C |
| InChI | InChI=1S/C13H18BrN/c1-4-13(3)9(2)7-10-5-6-11(14)8-12(10)15-13/h5-6,8-9,15H,4,7H2,1-3H3 |
| InChIKey | RYZQNSLSGJSHTP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |