C10H5F3O3S — CID 117196490
1,1-dioxo-7-(trifluoromethyl)-1-benzothiophene-2-carbaldehyde (PubChem CID 117196490) has the molecular formula C10H5F3O3S and a molecular weight of 262.21 g/mol. Its IUPAC name is 1,1-dioxo-7-(trifluoromethyl)-1-benzothiophene-2-carbaldehyde.
| Compound Name | 1,1-dioxo-7-(trifluoromethyl)-1-benzothiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 117196490 |
| Molecular Formula | C10H5F3O3S |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 1,1-dioxo-7-(trifluoromethyl)-1-benzothiophene-2-carbaldehyde |
| SMILES | O=CC1=Cc2cccc(C(F)(F)F)c2S1(=O)=O |
| InChI | InChI=1S/C10H5F3O3S/c11-10(12,13)8-3-1-2-6-4-7(5-14)17(15,16)9(6)8/h1-5H |
| InChIKey | MZOAOCDIEUIGHZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|