C18H26O3Si — CID 11723441
[(3R)-3-(1,3-benzodioxol-5-ylmethyl)cyclobuten-1-yl]oxy-triethylsilane (PubChem CID 11723441) has the molecular formula C18H26O3Si and a molecular weight of 318.49 g/mol. Its IUPAC name is [(3R)-3-(1,3-benzodioxol-5-ylmethyl)cyclobuten-1-yl]oxy-triethylsilane.
| Compound Name | [(3R)-3-(1,3-benzodioxol-5-ylmethyl)cyclobuten-1-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11723441 |
| Molecular Formula | C18H26O3Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [(3R)-3-(1,3-benzodioxol-5-ylmethyl)cyclobuten-1-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC1=C[C@H](Cc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C18H26O3Si/c1-4-22(5-2,6-3)21-16-10-15(11-16)9-14-7-8-17-18(12-14)20-13-19-17/h7-8,10,12,15H,4-6,9,11,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | RXARYCLHNHNCGL-HNNXBMFYSA-N |
| XLogP | 4.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|