C19H26O4 — CID 11726894
[5-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-3,4-dihydrochromen-6-yl] acetate (PubChem CID 11726894) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is [5-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [5-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 11726894 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [5-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)-3,4-dihydrochromen-6-yl] acetate |
| SMILES | COc1c2c(cc(CC=C(C)C)c1OC(C)=O)OC(C)(C)CC2 |
| InChI | InChI=1S/C19H26O4/c1-12(2)7-8-14-11-16-15(9-10-19(4,5)23-16)18(21-6)17(14)22-13(3)20/h7,11H,8-10H2,1-6H3 |
| InChIKey | ZFKNRLLYNPKKMM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|