C21H25NO6 — CID 162236159
(5-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-6-yl) (2S)-2-amino-3-methoxypropanoate (PubChem CID 162236159) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is (5-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-6-yl) (2S)-2-amino-3-methoxypropanoate.
| Compound Name | (5-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-6-yl) (2S)-2-amino-3-methoxypropanoate |
|---|---|
| PubChem CID | 162236159 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (5-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-6-yl) (2S)-2-amino-3-methoxypropanoate |
| SMILES | COC[C@H](N)C(=O)Oc1c(OC(C)=O)c2c(c3ccccc13)OC(C)(C)CC2 |
| InChI | InChI=1S/C21H25NO6/c1-12(23)26-19-15-9-10-21(2,3)28-17(15)13-7-5-6-8-14(13)18(19)27-20(24)16(22)11-25-4/h5-8,16H,9-11,22H2,1-4H3/t16-/m0/s1 |
| InChIKey | HXVALOIBLPORBI-INIZCTEOSA-N |
| XLogP | 2.75 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|