C38H40O11 — CID 161074046
acetyl acetate;(6-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-yl) acetate;2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione (PubChem CID 161074046) has the molecular formula C38H40O11 and a molecular weight of 672.73 g/mol. Its IUPAC name is acetyl acetate;(6-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-yl) acetate;2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione.
| Compound Name | acetyl acetate;(6-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-yl) acetate;2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
|---|---|
| PubChem CID | 161074046 |
| Molecular Formula | C38H40O11 |
| Molecular Weight | 672.73 g/mol |
| Exact Mass | 672.26 |
| IUPAC Name | acetyl acetate;(6-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-yl) acetate;2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5,6-dione |
| SMILES | CC(=O)OC(C)=O.CC(=O)Oc1c2c(c3ccccc3c1OC(C)=O)OC(C)(C)CC2.CC1(C)CCC2=C(O1)c1ccccc1C(=O)C2=O |
| InChI | InChI=1S/C19H20O5.C15H14O3.C4H6O3/c1-11(20)22-17-14-8-6-5-7-13(14)16-15(18(17)23-12(2)21)9-10-19(3,4)24-16;1-15(2)8-7-11-13(17)12(16)9-5-3-4-6-10(9)14(11)18-15;1-3(5)7-4(2)6/h5-8H,9-10H2,1-4H3;3-6H,7-8H2,1-2H3;1-2H3 |
| InChIKey | UFAKOXHRQYOSSG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.73 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|