C24H30NO5+ — CID 58601418
(5-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-6-yl) 2-piperidin-1-ium-4-ylacetate (PubChem CID 58601418) has the molecular formula C24H30NO5+ and a molecular weight of 412.51 g/mol. Its IUPAC name is (5-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-6-yl) 2-piperidin-1-ium-4-ylacetate.
| Compound Name | (5-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-6-yl) 2-piperidin-1-ium-4-ylacetate |
|---|---|
| PubChem CID | 58601418 |
| Molecular Formula | C24H30NO5+ |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (5-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-6-yl) 2-piperidin-1-ium-4-ylacetate |
| SMILES | CC(=O)Oc1c2c(c3ccccc3c1OC(=O)CC1CC[NH2+]CC1)OC(C)(C)CC2 |
| InChI | InChI=1S/C24H29NO5/c1-15(26)28-23-19-8-11-24(2,3)30-21(19)17-6-4-5-7-18(17)22(23)29-20(27)14-16-9-12-25-13-10-16/h4-7,16,25H,8-14H2,1-3H3/p+1 |
| InChIKey | LTCFXFGMTQNFRN-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|