C23H28ClNO5 — CID 143187483
(6-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-yl) 2-[chloro(ethyl)amino]-2-methylpropanoate (PubChem CID 143187483) has the molecular formula C23H28ClNO5 and a molecular weight of 433.93 g/mol. Its IUPAC name is (6-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-yl) 2-[chloro(ethyl)amino]-2-methylpropanoate.
| Compound Name | (6-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-yl) 2-[chloro(ethyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 143187483 |
| Molecular Formula | C23H28ClNO5 |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (6-acetyloxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromen-5-yl) 2-[chloro(ethyl)amino]-2-methylpropanoate |
| SMILES | CCN(Cl)C(C)(C)C(=O)Oc1c2c(c3ccccc3c1OC(C)=O)OC(C)(C)CC2 |
| InChI | InChI=1S/C23H28ClNO5/c1-7-25(24)23(5,6)21(27)29-20-17-12-13-22(3,4)30-18(17)15-10-8-9-11-16(15)19(20)28-14(2)26/h8-11H,7,12-13H2,1-6H3 |
| InChIKey | PMRZPKLEXWHAPI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|