C32H38O4 — CID 627589
3-(5-methoxy-2,2,8,8-tetramethyl-3,4,6,7-tetrahydropyrano[3,2-g]chromen-10-yl)-1,1-diphenylpropan-1-ol (PubChem CID 627589) has the molecular formula C32H38O4 and a molecular weight of 486.65 g/mol. Its IUPAC name is 3-(5-methoxy-2,2,8,8-tetramethyl-3,4,6,7-tetrahydropyrano[3,2-g]chromen-10-yl)-1,1-diphenylpropan-1-ol.
| Compound Name | 3-(5-methoxy-2,2,8,8-tetramethyl-3,4,6,7-tetrahydropyrano[3,2-g]chromen-10-yl)-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 627589 |
| Molecular Formula | C32H38O4 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 3-(5-methoxy-2,2,8,8-tetramethyl-3,4,6,7-tetrahydropyrano[3,2-g]chromen-10-yl)-1,1-diphenylpropan-1-ol |
| SMILES | COc1c2c(c(CCC(O)(c3ccccc3)c3ccccc3)c3c1CCC(C)(C)O3)OC(C)(C)CC2 |
| InChI | InChI=1S/C32H38O4/c1-30(2)19-16-24-27(34-5)25-17-20-31(3,4)36-29(25)26(28(24)35-30)18-21-32(33,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,33H,16-21H2,1-5H3 |
| InChIKey | NSRJIRXCIWLYNO-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |