C22H24O6 — CID 11783942
(6-acetyl-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-5-yl) 4-methoxybenzoate (PubChem CID 11783942) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is (6-acetyl-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-5-yl) 4-methoxybenzoate.
| Compound Name | (6-acetyl-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-5-yl) 4-methoxybenzoate |
|---|---|
| PubChem CID | 11783942 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (6-acetyl-7-methoxy-2,2-dimethyl-3,4-dihydrochromen-5-yl) 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2c3c(cc(OC)c2C(C)=O)OC(C)(C)CC3)cc1 |
| InChI | InChI=1S/C22H24O6/c1-13(23)19-18(26-5)12-17-16(10-11-22(2,3)28-17)20(19)27-21(24)14-6-8-15(25-4)9-7-14/h6-9,12H,10-11H2,1-5H3 |
| InChIKey | NSSHKZNTFRWPAH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|