C18H13ClN2O2S — CID 11728016
(2E)-2-benzylidene-N-(6-chloro-1,3-benzothiazol-2-yl)-3-oxobutanamide (PubChem CID 11728016) has the molecular formula C18H13ClN2O2S and a molecular weight of 356.83 g/mol. Its IUPAC name is (2E)-2-benzylidene-N-(6-chloro-1,3-benzothiazol-2-yl)-3-oxobutanamide.
| Compound Name | (2E)-2-benzylidene-N-(6-chloro-1,3-benzothiazol-2-yl)-3-oxobutanamide |
|---|---|
| PubChem CID | 11728016 |
| Molecular Formula | C18H13ClN2O2S |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | (2E)-2-benzylidene-N-(6-chloro-1,3-benzothiazol-2-yl)-3-oxobutanamide |
| SMILES | CC(=O)/C(=C\c1ccccc1)C(=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C18H13ClN2O2S/c1-11(22)14(9-12-5-3-2-4-6-12)17(23)21-18-20-15-8-7-13(19)10-16(15)24-18/h2-10H,1H3,(H,20,21,23)/b14-9+ |
| InChIKey | HUPYKWDWRUWBNF-NTEUORMPSA-N |
| XLogP | 4.56 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|