C22H36O2Si2 — CID 11728829
[5-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]cyclohexen-1-yl]methanol (PubChem CID 11728829) has the molecular formula C22H36O2Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]cyclohexen-1-yl]methanol.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]cyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 11728829 |
| Molecular Formula | C22H36O2Si2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-6-trimethylsilylhex-3-en-1,5-diynyl]cyclohexen-1-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC1(C#C/C=C\C#C[Si](C)(C)C)CCC=C(CO)C1 |
| InChI | InChI=1S/C22H36O2Si2/c1-21(2,3)26(7,8)24-22(16-13-14-20(18-22)19-23)15-11-9-10-12-17-25(4,5)6/h9-10,14,23H,13,16,18-19H2,1-8H3/b10-9- |
| InChIKey | ROFDSNJSSMXUJG-KTKRTIGZSA-N |
| XLogP | 5.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|