C26H45NO2Si — CID 11729706
(3S,5R,8R,9S,10S,13R,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 11729706) has the molecular formula C26H45NO2Si and a molecular weight of 431.74 g/mol. Its IUPAC name is (3S,5R,8R,9S,10S,13R,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (3S,5R,8R,9S,10S,13R,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 11729706 |
| Molecular Formula | C26H45NO2Si |
| Molecular Weight | 431.74 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | (3S,5R,8R,9S,10S,13R,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](C#N)CC[C@]32O)C1 |
| InChI | InChI=1S/C26H45NO2Si/c1-23(2,3)30(6,7)29-20-11-13-24(4)18(16-20)8-9-22-21(24)12-14-25(5)19(17-27)10-15-26(22,25)28/h18-22,28H,8-16H2,1-7H3/t18-,19-,20+,21+,22-,24+,25-,26+/m1/s1 |
| InChIKey | YWVDRYAVCNJRQW-VRVOEJAHSA-N |
| XLogP | 6.67 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.74 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|