C25H28N2OS2 — CID 11729814
(2R)-2-phenyl-2-[(1'R,12'S)-spiro[1,3-dithiane-2,11'-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene]-15'-yl]ethanol (PubChem CID 11729814) has the molecular formula C25H28N2OS2 and a molecular weight of 436.65 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[(1'R,12'S)-spiro[1,3-dithiane-2,11'-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene]-15'-yl]ethanol.
| Compound Name | (2R)-2-phenyl-2-[(1'R,12'S)-spiro[1,3-dithiane-2,11'-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene]-15'-yl]ethanol |
|---|---|
| PubChem CID | 11729814 |
| Molecular Formula | C25H28N2OS2 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (2R)-2-phenyl-2-[(1'R,12'S)-spiro[1,3-dithiane-2,11'-9,15-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene]-15'-yl]ethanol |
| SMILES | OC[C@@H](c1ccccc1)N1CC[C@H]2C[C@@H]1c1c([nH]c3ccccc13)C21SCCCS1 |
| InChI | InChI=1S/C25H28N2OS2/c28-16-22(17-7-2-1-3-8-17)27-12-11-18-15-21(27)23-19-9-4-5-10-20(19)26-24(23)25(18)29-13-6-14-30-25/h1-5,7-10,18,21-22,26,28H,6,11-16H2/t18-,21+,22-/m0/s1 |
| InChIKey | NAXYQAJRKYIEOY-BWAGFHJFSA-N |
| XLogP | 5.69 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |