C10H12O3S — CID 117303089
2-(5-methoxy-1,3-benzoxathiol-6-yl)ethanol (PubChem CID 117303089) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-(5-methoxy-1,3-benzoxathiol-6-yl)ethanol.
| Compound Name | 2-(5-methoxy-1,3-benzoxathiol-6-yl)ethanol |
|---|---|
| PubChem CID | 117303089 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-(5-methoxy-1,3-benzoxathiol-6-yl)ethanol |
| SMILES | COc1cc2c(cc1CCO)OCS2 |
| InChI | InChI=1S/C10H12O3S/c1-12-8-5-10-9(13-6-14-10)4-7(8)2-3-11/h4-5,11H,2-3,6H2,1H3 |
| InChIKey | PSLMPWMELZPHNQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |