C11H12N2O3 — CID 117313958
1-[2-(5-amino-1,2-oxazol-4-yl)phenyl]ethane-1,2-diol (PubChem CID 117313958) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-[2-(5-amino-1,2-oxazol-4-yl)phenyl]ethane-1,2-diol.
| Compound Name | 1-[2-(5-amino-1,2-oxazol-4-yl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 117313958 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-[2-(5-amino-1,2-oxazol-4-yl)phenyl]ethane-1,2-diol |
| SMILES | Nc1oncc1-c1ccccc1C(O)CO |
| InChI | InChI=1S/C11H12N2O3/c12-11-9(5-13-16-11)7-3-1-2-4-8(7)10(15)6-14/h1-5,10,14-15H,6,12H2 |
| InChIKey | ORCWSCFPKWWYLK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |