C26H39FO3 — CID 11761564
ethyl (4E,8Z)-4-fluoro-5,8,11,11-tetramethyl-2-(1-methylcyclopropanecarbonyl)pentadeca-4,8-dien-13-ynoate (PubChem CID 11761564) has the molecular formula C26H39FO3 and a molecular weight of 418.59 g/mol. Its IUPAC name is ethyl (4E,8Z)-4-fluoro-5,8,11,11-tetramethyl-2-(1-methylcyclopropanecarbonyl)pentadeca-4,8-dien-13-ynoate.
| Compound Name | ethyl (4E,8Z)-4-fluoro-5,8,11,11-tetramethyl-2-(1-methylcyclopropanecarbonyl)pentadeca-4,8-dien-13-ynoate |
|---|---|
| PubChem CID | 11761564 |
| Molecular Formula | C26H39FO3 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | ethyl (4E,8Z)-4-fluoro-5,8,11,11-tetramethyl-2-(1-methylcyclopropanecarbonyl)pentadeca-4,8-dien-13-ynoate |
| SMILES | CC#CCC(C)(C)C/C=C(/C)CC/C(C)=C(/F)CC(C(=O)OCC)C(=O)C1(C)CC1 |
| InChI | InChI=1S/C26H39FO3/c1-8-10-14-25(5,6)15-13-19(3)11-12-20(4)22(27)18-21(24(29)30-9-2)23(28)26(7)16-17-26/h13,21H,9,11-12,14-18H2,1-7H3/b19-13-,22-20+ |
| InChIKey | OKTILDFUMLCQNF-YJNSJFLASA-N |
| XLogP | 6.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|