C23H24O3 — CID 11772421
(1S,3Z,4aR,9bS)-1-butyl-3-[hydroxy(phenyl)methylidene]-1,2,4a,9b-tetrahydrodibenzofuran-4-one (PubChem CID 11772421) has the molecular formula C23H24O3 and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,3Z,4aR,9bS)-1-butyl-3-[hydroxy(phenyl)methylidene]-1,2,4a,9b-tetrahydrodibenzofuran-4-one.
| Compound Name | (1S,3Z,4aR,9bS)-1-butyl-3-[hydroxy(phenyl)methylidene]-1,2,4a,9b-tetrahydrodibenzofuran-4-one |
|---|---|
| PubChem CID | 11772421 |
| Molecular Formula | C23H24O3 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (1S,3Z,4aR,9bS)-1-butyl-3-[hydroxy(phenyl)methylidene]-1,2,4a,9b-tetrahydrodibenzofuran-4-one |
| SMILES | CCCC[C@H]1C/C(=C(/O)c2ccccc2)C(=O)[C@@H]2Oc3ccccc3[C@H]12 |
| InChI | InChI=1S/C23H24O3/c1-2-3-9-16-14-18(21(24)15-10-5-4-6-11-15)22(25)23-20(16)17-12-7-8-13-19(17)26-23/h4-8,10-13,16,20,23-24H,2-3,9,14H2,1H3/b21-18-/t16-,20-,23+/m0/s1 |
| InChIKey | SALGEIJHGPONHK-IDNOVGEMSA-N |
| XLogP | 5.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|