C29H36N2O3 — CID 67000850
3,5-bis[diethylamino(phenyl)methylidene]-4-oxocyclohexane-1-carboxylic acid (PubChem CID 67000850) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is 3,5-bis[diethylamino(phenyl)methylidene]-4-oxocyclohexane-1-carboxylic acid.
| Compound Name | 3,5-bis[diethylamino(phenyl)methylidene]-4-oxocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67000850 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 3,5-bis[diethylamino(phenyl)methylidene]-4-oxocyclohexane-1-carboxylic acid |
| SMILES | CCN(CC)C(=C1CC(C(=O)O)CC(=C(c2ccccc2)N(CC)CC)C1=O)c1ccccc1 |
| InChI | InChI=1S/C29H36N2O3/c1-5-30(6-2)26(21-15-11-9-12-16-21)24-19-23(29(33)34)20-25(28(24)32)27(31(7-3)8-4)22-17-13-10-14-18-22/h9-18,23H,5-8,19-20H2,1-4H3,(H,33,34) |
| InChIKey | LDZGWUYLKLLFJR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|