C21H24O6 — CID 11773156
tert-butyl 3-[3,6-dioxo-2-(phenylmethoxymethyl)cyclohexa-1,4-dien-1-yl]-3-hydroxypropanoate (PubChem CID 11773156) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is tert-butyl 3-[3,6-dioxo-2-(phenylmethoxymethyl)cyclohexa-1,4-dien-1-yl]-3-hydroxypropanoate.
| Compound Name | tert-butyl 3-[3,6-dioxo-2-(phenylmethoxymethyl)cyclohexa-1,4-dien-1-yl]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 11773156 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | tert-butyl 3-[3,6-dioxo-2-(phenylmethoxymethyl)cyclohexa-1,4-dien-1-yl]-3-hydroxypropanoate |
| SMILES | CC(C)(C)OC(=O)CC(O)C1=C(COCc2ccccc2)C(=O)C=CC1=O |
| InChI | InChI=1S/C21H24O6/c1-21(2,3)27-19(25)11-18(24)20-15(16(22)9-10-17(20)23)13-26-12-14-7-5-4-6-8-14/h4-10,18,24H,11-13H2,1-3H3 |
| InChIKey | DQMIKNFMRKCMOD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|