C17H26O3 — CID 11780859
(4R,5R)-5-[4-(methoxymethoxymethyl)phenyl]oct-7-en-4-ol (PubChem CID 11780859) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (4R,5R)-5-[4-(methoxymethoxymethyl)phenyl]oct-7-en-4-ol.
| Compound Name | (4R,5R)-5-[4-(methoxymethoxymethyl)phenyl]oct-7-en-4-ol |
|---|---|
| PubChem CID | 11780859 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (4R,5R)-5-[4-(methoxymethoxymethyl)phenyl]oct-7-en-4-ol |
| SMILES | C=CC[C@H](c1ccc(COCOC)cc1)[C@H](O)CCC |
| InChI | InChI=1S/C17H26O3/c1-4-6-16(17(18)7-5-2)15-10-8-14(9-11-15)12-20-13-19-3/h4,8-11,16-18H,1,5-7,12-13H2,2-3H3/t16-,17-/m1/s1 |
| InChIKey | NYAMMIOSRZIWNG-IAGOWNOFSA-N |
| XLogP | 3.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|