C19H22O2 — CID 11781002
(1R,2S,7R,8S)-11-(6-methylhept-5-en-2-ylidene)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 11781002) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1R,2S,7R,8S)-11-(6-methylhept-5-en-2-ylidene)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1R,2S,7R,8S)-11-(6-methylhept-5-en-2-ylidene)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 11781002 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (1R,2S,7R,8S)-11-(6-methylhept-5-en-2-ylidene)tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | CC(C)=CCC/C(C)=C1\[C@H]2C=C[C@@H]1[C@@H]1C(=O)C=CC(=O)[C@@H]12 |
| InChI | InChI=1S/C19H22O2/c1-11(2)5-4-6-12(3)17-13-7-8-14(17)19-16(21)10-9-15(20)18(13)19/h5,7-10,13-14,18-19H,4,6H2,1-3H3/b17-12-/t13-,14+,18+,19-/m0/s1 |
| InChIKey | NROIXQXTTXFRHE-LTIOHHDDSA-N |
| XLogP | 3.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|