C22H33FO2 — CID 122503859
5-[(2E,6E,10E)-12-fluoro-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-hydroxy-6-methylcyclohex-2-en-1-one (PubChem CID 122503859) has the molecular formula C22H33FO2 and a molecular weight of 348.50 g/mol. Its IUPAC name is 5-[(2E,6E,10E)-12-fluoro-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-hydroxy-6-methylcyclohex-2-en-1-one.
| Compound Name | 5-[(2E,6E,10E)-12-fluoro-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-hydroxy-6-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 122503859 |
| Molecular Formula | C22H33FO2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 5-[(2E,6E,10E)-12-fluoro-3,7,11-trimethyldodeca-2,6,10-trienyl]-4-hydroxy-6-methylcyclohex-2-en-1-one |
| SMILES | C/C(=C\CC/C(C)=C/CC/C(C)=C/CC1C(O)C=CC(=O)C1C)CF |
| InChI | InChI=1S/C22H33FO2/c1-16(8-6-10-18(3)15-23)7-5-9-17(2)11-12-20-19(4)21(24)13-14-22(20)25/h7,10-11,13-14,19-20,22,25H,5-6,8-9,12,15H2,1-4H3/b16-7+,17-11+,18-10+ |
| InChIKey | GMSHLVULSGKCLE-HRKXERGNSA-N |
| XLogP | 5.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|