C18H26O4 — CID 91517584
2-[1-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-2-oxocyclohex-3-en-1-yl]acetic acid (PubChem CID 91517584) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-[1-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-2-oxocyclohex-3-en-1-yl]acetic acid.
| Compound Name | 2-[1-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-2-oxocyclohex-3-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 91517584 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[1-(3,7-dimethylocta-2,6-dienyl)-5-hydroxy-2-oxocyclohex-3-en-1-yl]acetic acid |
| SMILES | CC(C)=CCCC(C)=CCC1(CC(=O)O)CC(O)C=CC1=O |
| InChI | InChI=1S/C18H26O4/c1-13(2)5-4-6-14(3)9-10-18(12-17(21)22)11-15(19)7-8-16(18)20/h5,7-9,15,19H,4,6,10-12H2,1-3H3,(H,21,22) |
| InChIKey | FYHIFNANGZTAMJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|