C24H32O5 — CID 123918224
[(1R,9S)-1-(2,6-dimethylhepta-1,5-dienyl)-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] cyclopentanecarboxylate (PubChem CID 123918224) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is [(1R,9S)-1-(2,6-dimethylhepta-1,5-dienyl)-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] cyclopentanecarboxylate.
| Compound Name | [(1R,9S)-1-(2,6-dimethylhepta-1,5-dienyl)-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 123918224 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(1R,9S)-1-(2,6-dimethylhepta-1,5-dienyl)-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] cyclopentanecarboxylate |
| SMILES | CC(C)=CCCC(C)=C[C@H]1OC(=O)CC12C[C@H](OC(=O)C1CCCC1)C=CC2=O |
| InChI | InChI=1S/C24H32O5/c1-16(2)7-6-8-17(3)13-21-24(15-22(26)29-21)14-19(11-12-20(24)25)28-23(27)18-9-4-5-10-18/h7,11-13,18-19,21H,4-6,8-10,14-15H2,1-3H3/t19-,21-,24?/m1/s1 |
| InChIKey | LRPYAFARYYAPCD-MRBOTJLVSA-N |
| XLogP | 4.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|