C20H26O6 — CID 118579640
[(1R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 2-hydroxyacetate (PubChem CID 118579640) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [(1R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 2-hydroxyacetate.
| Compound Name | [(1R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 118579640 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(1R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 2-hydroxyacetate |
| SMILES | CC(C)=CCC/C(C)=C/[C@H]1OC(=O)CC12C[C@H](OC(=O)CO)C=CC2=O |
| InChI | InChI=1S/C20H26O6/c1-13(2)5-4-6-14(3)9-17-20(11-18(23)26-17)10-15(7-8-16(20)22)25-19(24)12-21/h5,7-9,15,17,21H,4,6,10-12H2,1-3H3/b14-9+/t15-,17-,20?/m1/s1 |
| InChIKey | OYUZQIIHMOPQEY-AMWGXJEGSA-N |
| XLogP | 2.41 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|