C25H27FO5 — CID 72694580
[(1R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 2-fluorobenzoate (PubChem CID 72694580) has the molecular formula C25H27FO5 and a molecular weight of 426.48 g/mol. Its IUPAC name is [(1R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 2-fluorobenzoate.
| Compound Name | [(1R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 72694580 |
| Molecular Formula | C25H27FO5 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [(1R,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-3,6-dioxo-2-oxaspiro[4.5]dec-7-en-9-yl] 2-fluorobenzoate |
| SMILES | CC(C)=CCC/C(C)=C/[C@H]1OC(=O)CC12C[C@H](OC(=O)c1ccccc1F)C=CC2=O |
| InChI | InChI=1S/C25H27FO5/c1-16(2)7-6-8-17(3)13-22-25(15-23(28)31-22)14-18(11-12-21(25)27)30-24(29)19-9-4-5-10-20(19)26/h4-5,7,9-13,18,22H,6,8,14-15H2,1-3H3/b17-13+/t18-,22-,25?/m1/s1 |
| InChIKey | LLVGAAZTEVHDTH-GAEAPNBPSA-N |
| XLogP | 4.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|