C19H28O5 — CID 72695693
(1R,8S,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-9-hydroxy-8-methoxy-2-oxaspiro[4.5]decane-3,6-dione (PubChem CID 72695693) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (1R,8S,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-9-hydroxy-8-methoxy-2-oxaspiro[4.5]decane-3,6-dione.
| Compound Name | (1R,8S,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-9-hydroxy-8-methoxy-2-oxaspiro[4.5]decane-3,6-dione |
|---|---|
| PubChem CID | 72695693 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (1R,8S,9S)-1-[(1E)-2,6-dimethylhepta-1,5-dienyl]-9-hydroxy-8-methoxy-2-oxaspiro[4.5]decane-3,6-dione |
| SMILES | CO[C@H]1CC(=O)C2(CC(=O)O[C@@H]2/C=C(\C)CCC=C(C)C)C[C@@H]1O |
| InChI | InChI=1S/C19H28O5/c1-12(2)6-5-7-13(3)8-17-19(11-18(22)24-17)10-14(20)15(23-4)9-16(19)21/h6,8,14-15,17,20H,5,7,9-11H2,1-4H3/b13-8+/t14-,15-,17+,19?/m0/s1 |
| InChIKey | RNXGMPDMYPADJI-VROHWAKZSA-N |
| XLogP | 2.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|