C20H30O5 — CID 162932988
methyl 2-[(1R,4S,5S,7R)-7-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-methoxy-2-oxo-6-oxabicyclo[3.2.1]octan-1-yl]acetate (PubChem CID 162932988) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is methyl 2-[(1R,4S,5S,7R)-7-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-methoxy-2-oxo-6-oxabicyclo[3.2.1]octan-1-yl]acetate.
| Compound Name | methyl 2-[(1R,4S,5S,7R)-7-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-methoxy-2-oxo-6-oxabicyclo[3.2.1]octan-1-yl]acetate |
|---|---|
| PubChem CID | 162932988 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | methyl 2-[(1R,4S,5S,7R)-7-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-methoxy-2-oxo-6-oxabicyclo[3.2.1]octan-1-yl]acetate |
| SMILES | COC(=O)C[C@]12C[C@H](O[C@@H]1/C=C(\C)CCC=C(C)C)[C@@H](OC)CC2=O |
| InChI | InChI=1S/C20H30O5/c1-13(2)7-6-8-14(3)9-18-20(12-19(22)24-5)11-16(25-18)15(23-4)10-17(20)21/h7,9,15-16,18H,6,8,10-12H2,1-5H3/b14-9+/t15-,16-,18+,20-/m0/s1 |
| InChIKey | UQMNIDMLSKXSQI-YKCJTAFSSA-N |
| XLogP | 3.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|