C19H26O4 — CID 73025982
methyl 2-[7-(2,6-dimethylhepta-1,5-dienyl)-2-oxo-6-oxabicyclo[3.2.1]oct-3-en-1-yl]acetate (PubChem CID 73025982) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl 2-[7-(2,6-dimethylhepta-1,5-dienyl)-2-oxo-6-oxabicyclo[3.2.1]oct-3-en-1-yl]acetate.
| Compound Name | methyl 2-[7-(2,6-dimethylhepta-1,5-dienyl)-2-oxo-6-oxabicyclo[3.2.1]oct-3-en-1-yl]acetate |
|---|---|
| PubChem CID | 73025982 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl 2-[7-(2,6-dimethylhepta-1,5-dienyl)-2-oxo-6-oxabicyclo[3.2.1]oct-3-en-1-yl]acetate |
| SMILES | COC(=O)CC12CC(C=CC1=O)OC2C=C(C)CCC=C(C)C |
| InChI | InChI=1S/C19H26O4/c1-13(2)6-5-7-14(3)10-17-19(12-18(21)22-4)11-15(23-17)8-9-16(19)20/h6,8-10,15,17H,5,7,11-12H2,1-4H3 |
| InChIKey | MOGLHHCTNHEXAL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|