About dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate
dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate (PubChem CID 11783093) has the molecular formula C17H15ClO6
and a molecular weight of 350.75 g/mol. Its IUPAC name is dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate |
| PubChem CID | 11783093 |
| Molecular Formula | C17H15ClO6 |
| Molecular Weight | 350.75 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(c3ccc(Cl)cc3)CCC(=O)[C@@H]1O2 |
| InChI | InChI=1S/C17H15ClO6/c1-22-15(20)12-13(16(21)23-2)17(8-7-11(19)14(12)24-17)9-3-5-10(18)6-4-9/h3-6,14H,7-8H2,1-2H3/t14-,17-/m0/s1 |
| InChIKey | LLKRWVWXZRFPJM-YOEHRIQHSA-N |
| XLogP | 1.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.75 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate?
The IUPAC name of dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate (CID 11783093) is dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate.
What is the SMILES notation for dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate?
The canonical SMILES for dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate is COC(=O)C1=C(C(=O)OC)[C@@]2(c3ccc(Cl)cc3)CCC(=O)[C@@H]1O2.
What is the InChIKey of dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate?
The InChIKey is LLKRWVWXZRFPJM-YOEHRIQHSA-N. The full InChI is InChI=1S/C17H15ClO6/c1-22-15(20)12-13(16(21)23-2)17(8-7-11(19)14(12)24-17)9-3-5-10(18)6-4-9/h3-6,14H,7-8H2,1-2H3/t14-,17-/m0/s1.
What are the key properties of dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate?
dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate has a molecular weight of 350.75 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (1S,5R)-1-(4-chlorophenyl)-4-oxo-8-oxabicyclo[3.2.1]oct-6-ene-6,7-dicarboxylate is sourced from PubChem (CID 11783093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).