C19H34O4SSi — CID 11784011
(5R)-4-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexan-2-ol (PubChem CID 11784011) has the molecular formula C19H34O4SSi and a molecular weight of 386.63 g/mol. Its IUPAC name is (5R)-4-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexan-2-ol.
| Compound Name | (5R)-4-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 11784011 |
| Molecular Formula | C19H34O4SSi |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (5R)-4-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-5-methylhexan-2-ol |
| SMILES | CC(O)CC([C@H](C)CO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H34O4SSi/c1-15(14-23-25(6,7)19(3,4)5)18(13-16(2)20)24(21,22)17-11-9-8-10-12-17/h8-12,15-16,18,20H,13-14H2,1-7H3/t15-,16?,18?/m1/s1 |
| InChIKey | OFYLVGXANVODOM-KLHKWILBSA-N |
| XLogP | 4.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|