C28H34O5SSi — CID 11785536
[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-[(2S)-oxiran-2-yl]propyl] 4-methylbenzenesulfonate (PubChem CID 11785536) has the molecular formula C28H34O5SSi and a molecular weight of 510.73 g/mol. Its IUPAC name is [(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-[(2S)-oxiran-2-yl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-[(2S)-oxiran-2-yl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11785536 |
| Molecular Formula | C28H34O5SSi |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | [(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-[(2S)-oxiran-2-yl]propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](C[C@H]2CO2)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H34O5SSi/c1-22-15-17-25(18-16-22)34(29,30)32-21-24(19-23-20-31-23)33-35(28(2,3)4,26-11-7-5-8-12-26)27-13-9-6-10-14-27/h5-18,23-24H,19-21H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | QRVJIXYALPIUHY-ZEQRLZLVSA-N |
| XLogP | 4.43 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|