C18H13Cl5O6 — CID 11799620
2-[4-[1-[4-(carboxymethoxy)-3-chlorophenyl]-2,2,2-trichloroethyl]-2-chlorophenoxy]acetic acid (PubChem CID 11799620) has the molecular formula C18H13Cl5O6 and a molecular weight of 502.56 g/mol. Its IUPAC name is 2-[4-[1-[4-(carboxymethoxy)-3-chlorophenyl]-2,2,2-trichloroethyl]-2-chlorophenoxy]acetic acid.
| Compound Name | 2-[4-[1-[4-(carboxymethoxy)-3-chlorophenyl]-2,2,2-trichloroethyl]-2-chlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 11799620 |
| Molecular Formula | C18H13Cl5O6 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 499.92 |
| IUPAC Name | 2-[4-[1-[4-(carboxymethoxy)-3-chlorophenyl]-2,2,2-trichloroethyl]-2-chlorophenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C(c2ccc(OCC(=O)O)c(Cl)c2)C(Cl)(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl5O6/c19-11-5-9(1-3-13(11)28-7-15(24)25)17(18(21,22)23)10-2-4-14(12(20)6-10)29-8-16(26)27/h1-6,17H,7-8H2,(H,24,25)(H,26,27) |
| InChIKey | INNATJFDRFRPKD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|