C10H13NO3S2 — CID 118000066
[(5E)-5-(2,2-dimethylpropylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate (PubChem CID 118000066) has the molecular formula C10H13NO3S2 and a molecular weight of 259.35 g/mol. Its IUPAC name is [(5E)-5-(2,2-dimethylpropylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate.
| Compound Name | [(5E)-5-(2,2-dimethylpropylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate |
|---|---|
| PubChem CID | 118000066 |
| Molecular Formula | C10H13NO3S2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | [(5E)-5-(2,2-dimethylpropylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate |
| SMILES | CC(C)(C)/C=C1/SC(=S)N(COC=O)C1=O |
| InChI | InChI=1S/C10H13NO3S2/c1-10(2,3)4-7-8(13)11(5-14-6-12)9(15)16-7/h4,6H,5H2,1-3H3/b7-4+ |
| InChIKey | PXHAQCUBDLDTDT-QPJJXVBHSA-N |
| XLogP | 1.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|