C19H30N2O7 — CID 118011610
[(2S,5S,6S)-3,4,5-trihydroxy-2,6-dimethylcyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 118011610) has the molecular formula C19H30N2O7 and a molecular weight of 398.46 g/mol. Its IUPAC name is [(2S,5S,6S)-3,4,5-trihydroxy-2,6-dimethylcyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | [(2S,5S,6S)-3,4,5-trihydroxy-2,6-dimethylcyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 118011610 |
| Molecular Formula | C19H30N2O7 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [(2S,5S,6S)-3,4,5-trihydroxy-2,6-dimethylcyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CCN1C(=O)CC2(CCN(C(=O)OC3[C@@H](C)C(O)C(O)[C@@H](O)[C@@H]3C)CC2)C1=O |
| InChI | InChI=1S/C19H30N2O7/c1-4-21-12(22)9-19(17(21)26)5-7-20(8-6-19)18(27)28-16-10(2)13(23)15(25)14(24)11(16)3/h10-11,13-16,23-25H,4-9H2,1-3H3/t10-,11-,13-,14?,15?,16?/m0/s1 |
| InChIKey | IJYALPXSLKOXPO-VFEJKDKOSA-N |
| XLogP | -0.28 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|