C17H20N2O9 — CID 158863503
(2,3,4,5-tetrahydroxy-6-oxocyclohexa-2,4-dien-1-yl) 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 158863503) has the molecular formula C17H20N2O9 and a molecular weight of 396.35 g/mol. Its IUPAC name is (2,3,4,5-tetrahydroxy-6-oxocyclohexa-2,4-dien-1-yl) 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | (2,3,4,5-tetrahydroxy-6-oxocyclohexa-2,4-dien-1-yl) 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 158863503 |
| Molecular Formula | C17H20N2O9 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (2,3,4,5-tetrahydroxy-6-oxocyclohexa-2,4-dien-1-yl) 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CCN1C(=O)CC2(CCN(C(=O)OC3C(=O)C(O)=C(O)C(O)=C3O)CC2)C1=O |
| InChI | InChI=1S/C17H20N2O9/c1-2-19-8(20)7-17(15(19)26)3-5-18(6-4-17)16(27)28-14-12(24)10(22)9(21)11(23)13(14)25/h14,21-24H,2-7H2,1H3 |
| InChIKey | JAYAUAREAJEQHA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 164.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|