C17H26N2O9 — CID 74221945
[(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 74221945) has the molecular formula C17H26N2O9 and a molecular weight of 402.40 g/mol. Its IUPAC name is [(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | [(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 74221945 |
| Molecular Formula | C17H26N2O9 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [(2S,3R,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl] 2-ethyl-1,3-dioxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CCN1C(=O)CC2(CCN(C(=O)OC3[C@@H](O)[C@H](O)C(O)[C@H](O)[C@H]3O)CC2)C1=O |
| InChI | InChI=1S/C17H26N2O9/c1-2-19-8(20)7-17(15(19)26)3-5-18(6-4-17)16(27)28-14-12(24)10(22)9(21)11(23)13(14)25/h9-14,21-25H,2-7H2,1H3/t9?,10-,11+,12+,13-,14? |
| InChIKey | ZNLFRSDBUXPENV-BJIAHVAYSA-N |
| XLogP | -2.83 |
| TPSA | 168.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|