C29H30O7 — CID 118015895
(4aS,11aR,12aS)-3-acetyl-4,4a,5,7-tetrahydroxy-10-[2-(4-methylphenyl)ethyl]-5,5a,11,11a,12,12a-hexahydro-1H-tetracene-2,6-dione (PubChem CID 118015895) has the molecular formula C29H30O7 and a molecular weight of 490.55 g/mol. Its IUPAC name is (4aS,11aR,12aS)-3-acetyl-4,4a,5,7-tetrahydroxy-10-[2-(4-methylphenyl)ethyl]-5,5a,11,11a,12,12a-hexahydro-1H-tetracene-2,6-dione.
| Compound Name | (4aS,11aR,12aS)-3-acetyl-4,4a,5,7-tetrahydroxy-10-[2-(4-methylphenyl)ethyl]-5,5a,11,11a,12,12a-hexahydro-1H-tetracene-2,6-dione |
|---|---|
| PubChem CID | 118015895 |
| Molecular Formula | C29H30O7 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (4aS,11aR,12aS)-3-acetyl-4,4a,5,7-tetrahydroxy-10-[2-(4-methylphenyl)ethyl]-5,5a,11,11a,12,12a-hexahydro-1H-tetracene-2,6-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(O)C3C(=O)c4c(O)ccc(CCc5ccc(C)cc5)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C29H30O7/c1-14-3-5-16(6-4-14)7-8-17-9-10-21(31)25-20(17)12-18-11-19-13-22(32)23(15(2)30)27(34)29(19,36)28(35)24(18)26(25)33/h3-6,9-10,18-19,24,28,31,34-36H,7-8,11-13H2,1-2H3/t18-,19+,24?,28?,29-/m1/s1 |
| InChIKey | BQUSJKUCHZFKCH-PYZZDKQBSA-N |
| XLogP | 2.94 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|