C20H21N3O10 — CID 54750949
(6S)-7-amino-1,6,10,12,12a-pentahydroxy-6-methyl-9-nitro-3,11-dioxo-4,4a,5,5a,11a,12-hexahydrotetracene-2-carboxamide (PubChem CID 54750949) has the molecular formula C20H21N3O10 and a molecular weight of 463.40 g/mol. Its IUPAC name is (6S)-7-amino-1,6,10,12,12a-pentahydroxy-6-methyl-9-nitro-3,11-dioxo-4,4a,5,5a,11a,12-hexahydrotetracene-2-carboxamide.
| Compound Name | (6S)-7-amino-1,6,10,12,12a-pentahydroxy-6-methyl-9-nitro-3,11-dioxo-4,4a,5,5a,11a,12-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54750949 |
| Molecular Formula | C20H21N3O10 |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (6S)-7-amino-1,6,10,12,12a-pentahydroxy-6-methyl-9-nitro-3,11-dioxo-4,4a,5,5a,11a,12-hexahydrotetracene-2-carboxamide |
| SMILES | C[C@@]1(O)c2c(N)cc([N+](=O)[O-])c(O)c2C(=O)C2C(O)C3(O)C(O)=C(C(N)=O)C(=O)CC3CC21 |
| InChI | InChI=1S/C20H21N3O10/c1-19(30)6-2-5-3-9(24)11(18(22)29)17(28)20(5,31)16(27)10(6)15(26)12-13(19)7(21)4-8(14(12)25)23(32)33/h4-6,10,16,25,27-28,30-31H,2-3,21H2,1H3,(H2,22,29)/t5?,6?,10?,16?,19-,20?/m0/s1 |
| InChIKey | LBCSIEZNOAOVMF-UXJAGKIQSA-N |
| XLogP | -1.10 |
| TPSA | 247.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|