C20H21N4O8+ — CID 54750947
[(5S)-9-carbamoyl-1,5,10,10a,11-pentahydroxy-5-methyl-8,12-dioxo-5a,6,6a,7,11,11a-hexahydrotetracen-2-yl]imino-iminoazanium (PubChem CID 54750947) has the molecular formula C20H21N4O8+ and a molecular weight of 445.41 g/mol. Its IUPAC name is [(5S)-9-carbamoyl-1,5,10,10a,11-pentahydroxy-5-methyl-8,12-dioxo-5a,6,6a,7,11,11a-hexahydrotetracen-2-yl]imino-iminoazanium.
| Compound Name | [(5S)-9-carbamoyl-1,5,10,10a,11-pentahydroxy-5-methyl-8,12-dioxo-5a,6,6a,7,11,11a-hexahydrotetracen-2-yl]imino-iminoazanium |
|---|---|
| PubChem CID | 54750947 |
| Molecular Formula | C20H21N4O8+ |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | [(5S)-9-carbamoyl-1,5,10,10a,11-pentahydroxy-5-methyl-8,12-dioxo-5a,6,6a,7,11,11a-hexahydrotetracen-2-yl]imino-iminoazanium |
| SMILES | C[C@@]1(O)c2ccc(N=[N+]=N)c(O)c2C(=O)C2C(O)C3(O)C(O)=C(C(N)=O)C(=O)CC3CC21 |
| InChI | InChI=1S/C20H20N4O8/c1-19(31)7-2-3-9(23-24-22)14(26)11(7)15(27)12-8(19)4-6-5-10(25)13(18(21)30)17(29)20(6,32)16(12)28/h2-3,6,8,12,16,22,28,31-32H,4-5H2,1H3,(H3,21,25,29,30)/p+1/t6?,8?,12?,16?,19-,20?/m1/s1 |
| InChIKey | XZYXMBCPAJKZOT-RUZKYLIISA-O |
| XLogP | -0.41 |
| TPSA | 228.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|