C17H18N2O6 — CID 70804496
(4aS,5aS,9aS)-9,9a,10-trihydroxy-7,11-dioxo-1,3a,4,4a,5,5a,6,11a-octahydronaphtho[2,3-f]indole-8-carboxamide (PubChem CID 70804496) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is (4aS,5aS,9aS)-9,9a,10-trihydroxy-7,11-dioxo-1,3a,4,4a,5,5a,6,11a-octahydronaphtho[2,3-f]indole-8-carboxamide.
| Compound Name | (4aS,5aS,9aS)-9,9a,10-trihydroxy-7,11-dioxo-1,3a,4,4a,5,5a,6,11a-octahydronaphtho[2,3-f]indole-8-carboxamide |
|---|---|
| PubChem CID | 70804496 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (4aS,5aS,9aS)-9,9a,10-trihydroxy-7,11-dioxo-1,3a,4,4a,5,5a,6,11a-octahydronaphtho[2,3-f]indole-8-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(O)=C3C(=O)C4NC=CC4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C17H18N2O6/c18-16(24)11-9(20)5-8-4-7-3-6-1-2-19-12(6)13(21)10(7)14(22)17(8,25)15(11)23/h1-2,6-8,12,19,22-23,25H,3-5H2,(H2,18,24)/t6?,7-,8-,12?,17-/m0/s1 |
| InChIKey | QLARFMOQMZHCLA-UBYWICEOSA-N |
| XLogP | -0.49 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|